C24H29ClN4O2 — CID 67244482
N'-(3-chlorophenyl)-4-[(2R)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]piperazine-1-carboximidamide (PubChem CID 67244482) has the molecular formula C24H29ClN4O2 and a molecular weight of 440.98 g/mol. Its IUPAC name is N'-(3-chlorophenyl)-4-[(2R)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]piperazine-1-carboximidamide.
| Compound Name | N'-(3-chlorophenyl)-4-[(2R)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 67244482 |
| Molecular Formula | C24H29ClN4O2 |
| Molecular Weight | 440.98 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | N'-(3-chlorophenyl)-4-[(2R)-2-cyclopentyl-2-hydroxy-2-phenylacetyl]piperazine-1-carboximidamide |
| SMILES | N/C(=N\c1cccc(Cl)c1)N1CCN(C(=O)[C@](O)(c2ccccc2)C2CCCC2)CC1 |
| InChI | InChI=1S/C24H29ClN4O2/c25-20-11-6-12-21(17-20)27-23(26)29-15-13-28(14-16-29)22(30)24(31,19-9-4-5-10-19)18-7-2-1-3-8-18/h1-3,6-8,11-12,17,19,31H,4-5,9-10,13-16H2,(H2,26,27)/t24-/m0/s1 |
| InChIKey | WJYZGFLBQSBSMX-DEOSSOPVSA-N |
| XLogP | 3.51 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.98 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|