C26H40N4O2 — CID 25221415
N'-(cycloheptylmethyl)-4-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)piperazine-1-carboximidamide (PubChem CID 25221415) has the molecular formula C26H40N4O2 and a molecular weight of 440.63 g/mol. Its IUPAC name is N'-(cycloheptylmethyl)-4-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)piperazine-1-carboximidamide.
| Compound Name | N'-(cycloheptylmethyl)-4-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 25221415 |
| Molecular Formula | C26H40N4O2 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.32 |
| IUPAC Name | N'-(cycloheptylmethyl)-4-(2-cyclopentyl-2-hydroxy-2-phenylacetyl)piperazine-1-carboximidamide |
| SMILES | N/C(=N\CC1CCCCCC1)N1CCN(C(=O)C(O)(c2ccccc2)C2CCCC2)CC1 |
| InChI | InChI=1S/C26H40N4O2/c27-25(28-20-21-10-4-1-2-5-11-21)30-18-16-29(17-19-30)24(31)26(32,23-14-8-9-15-23)22-12-6-3-7-13-22/h3,6-7,12-13,21,23,32H,1-2,4-5,8-11,14-20H2,(H2,27,28) |
| InChIKey | VBTKPRGXUKAIOB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|