C25H29F2N3O3 — CID 74433292
[1-[N'-[(3,5-difluorophenyl)methyl]carbamimidoyl]pyrrolidin-3-yl] 2-cyclopentyl-2-hydroxy-2-phenylacetate (PubChem CID 74433292) has the molecular formula C25H29F2N3O3 and a molecular weight of 457.52 g/mol. Its IUPAC name is [1-[N'-[(3,5-difluorophenyl)methyl]carbamimidoyl]pyrrolidin-3-yl] 2-cyclopentyl-2-hydroxy-2-phenylacetate.
| Compound Name | [1-[N'-[(3,5-difluorophenyl)methyl]carbamimidoyl]pyrrolidin-3-yl] 2-cyclopentyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 74433292 |
| Molecular Formula | C25H29F2N3O3 |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | [1-[N'-[(3,5-difluorophenyl)methyl]carbamimidoyl]pyrrolidin-3-yl] 2-cyclopentyl-2-hydroxy-2-phenylacetate |
| SMILES | N/C(=N\Cc1cc(F)cc(F)c1)N1CCC(OC(=O)C(O)(c2ccccc2)C2CCCC2)C1 |
| InChI | InChI=1S/C25H29F2N3O3/c26-20-12-17(13-21(27)14-20)15-29-24(28)30-11-10-22(16-30)33-23(31)25(32,19-8-4-5-9-19)18-6-2-1-3-7-18/h1-3,6-7,12-14,19,22,32H,4-5,8-11,15-16H2,(H2,28,29) |
| InChIKey | QEZKVMWYEVIZJH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|