C24H30N4O3 — CID 74433275
[1-[N'-(pyridin-2-ylmethyl)carbamimidoyl]pyrrolidin-3-yl] 2-cyclopentyl-2-hydroxy-2-phenylacetate (PubChem CID 74433275) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is [1-[N'-(pyridin-2-ylmethyl)carbamimidoyl]pyrrolidin-3-yl] 2-cyclopentyl-2-hydroxy-2-phenylacetate.
| Compound Name | [1-[N'-(pyridin-2-ylmethyl)carbamimidoyl]pyrrolidin-3-yl] 2-cyclopentyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 74433275 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | [1-[N'-(pyridin-2-ylmethyl)carbamimidoyl]pyrrolidin-3-yl] 2-cyclopentyl-2-hydroxy-2-phenylacetate |
| SMILES | N/C(=N\Cc1ccccn1)N1CCC(OC(=O)C(O)(c2ccccc2)C2CCCC2)C1 |
| InChI | InChI=1S/C24H30N4O3/c25-23(27-16-20-12-6-7-14-26-20)28-15-13-21(17-28)31-22(29)24(30,19-10-4-5-11-19)18-8-2-1-3-9-18/h1-3,6-9,12,14,19,21,30H,4-5,10-11,13,15-17H2,(H2,25,27) |
| InChIKey | IVQWQJWVFKIENZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 101.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|