C14H18F3N5O — CID 78093565
N'-[N'-[[4-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]pyrrolidine-1-carboximidamide (PubChem CID 78093565) has the molecular formula C14H18F3N5O and a molecular weight of 329.33 g/mol. Its IUPAC name is N'-[N'-[[4-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]pyrrolidine-1-carboximidamide.
| Compound Name | N'-[N'-[[4-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 78093565 |
| Molecular Formula | C14H18F3N5O |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | N'-[N'-[[4-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]pyrrolidine-1-carboximidamide |
| SMILES | NC(=N/C(N)=N/Cc1ccc(OC(F)(F)F)cc1)N1CCCC1 |
| InChI | InChI=1S/C14H18F3N5O/c15-14(16,17)23-11-5-3-10(4-6-11)9-20-12(18)21-13(19)22-7-1-2-8-22/h3-6H,1-2,7-9H2,(H4,18,19,20,21) |
| InChIKey | MTEXLPKIYJRGCW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|