C16H24Cl2F3N5O — CID 142722397
3-methyl-N'-[N'-[[4-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]piperidine-1-carboximidamide;dihydrochloride (PubChem CID 142722397) has the molecular formula C16H24Cl2F3N5O and a molecular weight of 430.30 g/mol. Its IUPAC name is 3-methyl-N'-[N'-[[4-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]piperidine-1-carboximidamide;dihydrochloride.
| Compound Name | 3-methyl-N'-[N'-[[4-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]piperidine-1-carboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 142722397 |
| Molecular Formula | C16H24Cl2F3N5O |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 3-methyl-N'-[N'-[[4-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]piperidine-1-carboximidamide;dihydrochloride |
| SMILES | CC1CCCN(/C(N)=N/C(N)=N/Cc2ccc(OC(F)(F)F)cc2)C1.Cl.Cl |
| InChI | InChI=1S/C16H22F3N5O.2ClH/c1-11-3-2-8-24(10-11)15(21)23-14(20)22-9-12-4-6-13(7-5-12)25-16(17,18)19;;/h4-7,11H,2-3,8-10H2,1H3,(H4,20,21,22,23);2*1H |
| InChIKey | MLJXCNQJQGHQKN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|