C15H23Cl2N5 — CID 158187066
N'-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]-3-methylpiperidine-1-carboximidamide;hydrochloride (PubChem CID 158187066) has the molecular formula C15H23Cl2N5 and a molecular weight of 344.29 g/mol. Its IUPAC name is N'-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]-3-methylpiperidine-1-carboximidamide;hydrochloride.
| Compound Name | N'-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]-3-methylpiperidine-1-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 158187066 |
| Molecular Formula | C15H23Cl2N5 |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | N'-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]-3-methylpiperidine-1-carboximidamide;hydrochloride |
| SMILES | CC1CCCN(C(N)=N/C(N)=N/Cc2ccc(Cl)cc2)C1.Cl |
| InChI | InChI=1S/C15H22ClN5.ClH/c1-11-3-2-8-21(10-11)15(18)20-14(17)19-9-12-4-6-13(16)7-5-12;/h4-7,11H,2-3,8-10H2,1H3,(H4,17,18,19,20);1H |
| InChIKey | QGKCCMRYGDUVSJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|