C18H27IN4 — CID 111816739
N'-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-3-methylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111816739) has the molecular formula C18H27IN4 and a molecular weight of 426.35 g/mol. Its IUPAC name is N'-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-3-methylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-3-methylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111816739 |
| Molecular Formula | C18H27IN4 |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | N'-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-3-methylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CC1CCCN(/C(N)=N/Cc2ccc(N3CC=CC3)cc2)C1.I |
| InChI | InChI=1S/C18H26N4.HI/c1-15-5-4-12-22(14-15)18(19)20-13-16-6-8-17(9-7-16)21-10-2-3-11-21;/h2-3,6-9,15H,4-5,10-14H2,1H3,(H2,19,20);1H |
| InChIKey | JGGQWWKAUZHXCF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|