C21H35N5 — CID 111053491
N'-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]-3-methylpiperidine-1-carboximidamide (PubChem CID 111053491) has the molecular formula C21H35N5 and a molecular weight of 357.55 g/mol. Its IUPAC name is N'-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]-3-methylpiperidine-1-carboximidamide.
| Compound Name | N'-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]-3-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111053491 |
| Molecular Formula | C21H35N5 |
| Molecular Weight | 357.55 g/mol |
| Exact Mass | 357.29 |
| IUPAC Name | N'-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]-3-methylpiperidine-1-carboximidamide |
| SMILES | CCN1CCN(Cc2ccccc2C/N=C(\N)N2CCCC(C)C2)CC1 |
| InChI | InChI=1S/C21H35N5/c1-3-24-11-13-25(14-12-24)17-20-9-5-4-8-19(20)15-23-21(22)26-10-6-7-18(2)16-26/h4-5,8-9,18H,3,6-7,10-17H2,1-2H3,(H2,22,23) |
| InChIKey | VBHXKGOUGXARRQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 48.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.55 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|