C18H28N4O — CID 111063224
3-methyl-N'-[(2-morpholin-4-ylphenyl)methyl]piperidine-1-carboximidamide (PubChem CID 111063224) has the molecular formula C18H28N4O and a molecular weight of 316.45 g/mol. Its IUPAC name is 3-methyl-N'-[(2-morpholin-4-ylphenyl)methyl]piperidine-1-carboximidamide.
| Compound Name | 3-methyl-N'-[(2-morpholin-4-ylphenyl)methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111063224 |
| Molecular Formula | C18H28N4O |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | 3-methyl-N'-[(2-morpholin-4-ylphenyl)methyl]piperidine-1-carboximidamide |
| SMILES | CC1CCCN(/C(N)=N/Cc2ccccc2N2CCOCC2)C1 |
| InChI | InChI=1S/C18H28N4O/c1-15-5-4-8-22(14-15)18(19)20-13-16-6-2-3-7-17(16)21-9-11-23-12-10-21/h2-3,6-7,15H,4-5,8-14H2,1H3,(H2,19,20) |
| InChIKey | DQQNKXVWYFDSKT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|