C19H27F3N4O — CID 111069748
3-methyl-N'-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]methyl]piperidine-1-carboximidamide (PubChem CID 111069748) has the molecular formula C19H27F3N4O and a molecular weight of 384.45 g/mol. Its IUPAC name is 3-methyl-N'-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]methyl]piperidine-1-carboximidamide.
| Compound Name | 3-methyl-N'-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111069748 |
| Molecular Formula | C19H27F3N4O |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 3-methyl-N'-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]methyl]piperidine-1-carboximidamide |
| SMILES | CC1CCCN(/C(N)=N/Cc2ccc(N3CCOCC3)cc2C(F)(F)F)C1 |
| InChI | InChI=1S/C19H27F3N4O/c1-14-3-2-6-26(13-14)18(23)24-12-15-4-5-16(11-17(15)19(20,21)22)25-7-9-27-10-8-25/h4-5,11,14H,2-3,6-10,12-13H2,1H3,(H2,23,24) |
| InChIKey | VDWOJFCHJQNUSX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|