C18H27F3N4O — CID 111069706
1-(3-methylbutyl)-2-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111069706) has the molecular formula C18H27F3N4O and a molecular weight of 372.44 g/mol. Its IUPAC name is 1-(3-methylbutyl)-2-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 1-(3-methylbutyl)-2-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111069706 |
| Molecular Formula | C18H27F3N4O |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 1-(3-methylbutyl)-2-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | CC(C)CCN/C(N)=N/Cc1ccc(N2CCOCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C18H27F3N4O/c1-13(2)5-6-23-17(22)24-12-14-3-4-15(11-16(14)18(19,20)21)25-7-9-26-10-8-25/h3-4,11,13H,5-10,12H2,1-2H3,(H3,22,23,24) |
| InChIKey | CFKVFVIVDUTUKL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|