C17H25F3N4O — CID 52512397
1-[(2S)-butan-2-yl]-2-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 52512397) has the molecular formula C17H25F3N4O and a molecular weight of 358.41 g/mol. Its IUPAC name is 1-[(2S)-butan-2-yl]-2-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[(2S)-butan-2-yl]-2-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 52512397 |
| Molecular Formula | C17H25F3N4O |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 1-[(2S)-butan-2-yl]-2-[[4-morpholin-4-yl-2-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | CC[C@H](C)N/C(N)=N/Cc1ccc(N2CCOCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C17H25F3N4O/c1-3-12(2)23-16(21)22-11-13-4-5-14(10-15(13)17(18,19)20)24-6-8-25-9-7-24/h4-5,10,12H,3,6-9,11H2,1-2H3,(H3,21,22,23)/t12-/m0/s1 |
| InChIKey | GNTPYFFVEJLPJY-LBPRGKRZSA-N |
| XLogP | 2.74 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|