C19H31IN4O — CID 111048307
4-[[[amino-(3-methylpiperidin-1-yl)methylidene]amino]methyl]-N,N-diethylbenzamide;hydroiodide (PubChem CID 111048307) has the molecular formula C19H31IN4O and a molecular weight of 458.39 g/mol. Its IUPAC name is 4-[[[amino-(3-methylpiperidin-1-yl)methylidene]amino]methyl]-N,N-diethylbenzamide;hydroiodide.
| Compound Name | 4-[[[amino-(3-methylpiperidin-1-yl)methylidene]amino]methyl]-N,N-diethylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111048307 |
| Molecular Formula | C19H31IN4O |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 4-[[[amino-(3-methylpiperidin-1-yl)methylidene]amino]methyl]-N,N-diethylbenzamide;hydroiodide |
| SMILES | CCN(CC)C(=O)c1ccc(C/N=C(\N)N2CCCC(C)C2)cc1.I |
| InChI | InChI=1S/C19H30N4O.HI/c1-4-22(5-2)18(24)17-10-8-16(9-11-17)13-21-19(20)23-12-6-7-15(3)14-23;/h8-11,15H,4-7,12-14H2,1-3H3,(H2,20,21);1H |
| InChIKey | CQJISPXOUPSWOH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|