C14H22Cl2FN5 — CID 142722417
N'-[N'-(4-fluorophenyl)carbamimidoyl]-3-methylpiperidine-1-carboximidamide;dihydrochloride (PubChem CID 142722417) has the molecular formula C14H22Cl2FN5 and a molecular weight of 350.27 g/mol. Its IUPAC name is N'-[N'-(4-fluorophenyl)carbamimidoyl]-3-methylpiperidine-1-carboximidamide;dihydrochloride.
| Compound Name | N'-[N'-(4-fluorophenyl)carbamimidoyl]-3-methylpiperidine-1-carboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 142722417 |
| Molecular Formula | C14H22Cl2FN5 |
| Molecular Weight | 350.27 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | N'-[N'-(4-fluorophenyl)carbamimidoyl]-3-methylpiperidine-1-carboximidamide;dihydrochloride |
| SMILES | CC1CCCN(/C(N)=N\C(N)=N\c2ccc(F)cc2)C1.Cl.Cl |
| InChI | InChI=1S/C14H20FN5.2ClH/c1-10-3-2-8-20(9-10)14(17)19-13(16)18-12-6-4-11(15)5-7-12;;/h4-7,10H,2-3,8-9H2,1H3,(H4,16,17,18,19);2*1H |
| InChIKey | XNVMBYXAMUBHDO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|