C15H20F3N5O — CID 123330653
3-methyl-N'-[N'-[4-(trifluoromethoxy)phenyl]carbamimidoyl]piperidine-1-carboximidamide (PubChem CID 123330653) has the molecular formula C15H20F3N5O and a molecular weight of 343.35 g/mol. Its IUPAC name is 3-methyl-N'-[N'-[4-(trifluoromethoxy)phenyl]carbamimidoyl]piperidine-1-carboximidamide.
| Compound Name | 3-methyl-N'-[N'-[4-(trifluoromethoxy)phenyl]carbamimidoyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 123330653 |
| Molecular Formula | C15H20F3N5O |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 3-methyl-N'-[N'-[4-(trifluoromethoxy)phenyl]carbamimidoyl]piperidine-1-carboximidamide |
| SMILES | CC1CCCN(C(N)=N/C(N)=N/c2ccc(OC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C15H20F3N5O/c1-10-3-2-8-23(9-10)14(20)22-13(19)21-11-4-6-12(7-5-11)24-15(16,17)18/h4-7,10H,2-3,8-9H2,1H3,(H4,19,20,21,22) |
| InChIKey | KKDIKHPWJZHCGU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|