C15H20F3N5O3S — CID 118057191
4-methylsulfonyl-N'-[N'-[4-(trifluoromethoxy)phenyl]carbamimidoyl]piperidine-1-carboximidamide (PubChem CID 118057191) has the molecular formula C15H20F3N5O3S and a molecular weight of 407.42 g/mol. Its IUPAC name is 4-methylsulfonyl-N'-[N'-[4-(trifluoromethoxy)phenyl]carbamimidoyl]piperidine-1-carboximidamide.
| Compound Name | 4-methylsulfonyl-N'-[N'-[4-(trifluoromethoxy)phenyl]carbamimidoyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 118057191 |
| Molecular Formula | C15H20F3N5O3S |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 4-methylsulfonyl-N'-[N'-[4-(trifluoromethoxy)phenyl]carbamimidoyl]piperidine-1-carboximidamide |
| SMILES | CS(=O)(=O)C1CCN(/C(N)=N/C(N)=N/c2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C15H20F3N5O3S/c1-27(24,25)12-6-8-23(9-7-12)14(20)22-13(19)21-10-2-4-11(5-3-10)26-15(16,17)18/h2-5,12H,6-9H2,1H3,(H4,19,20,21,22) |
| InChIKey | QXMDFDCSYNWYDB-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 123.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|