C14H16F5N5O — CID 123271421
4,4-difluoro-N'-[N'-[4-(trifluoromethoxy)phenyl]carbamimidoyl]piperidine-1-carboximidamide (PubChem CID 123271421) has the molecular formula C14H16F5N5O and a molecular weight of 365.31 g/mol. Its IUPAC name is 4,4-difluoro-N'-[N'-[4-(trifluoromethoxy)phenyl]carbamimidoyl]piperidine-1-carboximidamide.
| Compound Name | 4,4-difluoro-N'-[N'-[4-(trifluoromethoxy)phenyl]carbamimidoyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 123271421 |
| Molecular Formula | C14H16F5N5O |
| Molecular Weight | 365.31 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 4,4-difluoro-N'-[N'-[4-(trifluoromethoxy)phenyl]carbamimidoyl]piperidine-1-carboximidamide |
| SMILES | NC(=N/C(N)=N/c1ccc(OC(F)(F)F)cc1)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H16F5N5O/c15-13(16)5-7-24(8-6-13)12(21)23-11(20)22-9-1-3-10(4-2-9)25-14(17,18)19/h1-4H,5-8H2,(H4,20,21,22,23) |
| InChIKey | WANQDAIUOOWGOP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|