C14H15F6N5O — CID 154018231
4,4-difluoro-N'-[N'-[3-fluoro-4-(trifluoromethoxy)phenyl]carbamimidoyl]piperidine-1-carboximidamide (PubChem CID 154018231) has the molecular formula C14H15F6N5O and a molecular weight of 383.30 g/mol. Its IUPAC name is 4,4-difluoro-N'-[N'-[3-fluoro-4-(trifluoromethoxy)phenyl]carbamimidoyl]piperidine-1-carboximidamide.
| Compound Name | 4,4-difluoro-N'-[N'-[3-fluoro-4-(trifluoromethoxy)phenyl]carbamimidoyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 154018231 |
| Molecular Formula | C14H15F6N5O |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 4,4-difluoro-N'-[N'-[3-fluoro-4-(trifluoromethoxy)phenyl]carbamimidoyl]piperidine-1-carboximidamide |
| SMILES | NC(=N/C(N)=N/c1ccc(OC(F)(F)F)c(F)c1)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H15F6N5O/c15-9-7-8(1-2-10(9)26-14(18,19)20)23-11(21)24-12(22)25-5-3-13(16,17)4-6-25/h1-2,7H,3-6H2,(H4,21,22,23,24) |
| InChIKey | HPZSPVXRGADMPT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|