C11H11ClF3N5O — CID 86343735
N'-[N'-[3-chloro-4-(trifluoromethoxy)phenyl]carbamimidoyl]aziridine-1-carboximidamide (PubChem CID 86343735) has the molecular formula C11H11ClF3N5O and a molecular weight of 321.69 g/mol. Its IUPAC name is N'-[N'-[3-chloro-4-(trifluoromethoxy)phenyl]carbamimidoyl]aziridine-1-carboximidamide.
| Compound Name | N'-[N'-[3-chloro-4-(trifluoromethoxy)phenyl]carbamimidoyl]aziridine-1-carboximidamide |
|---|---|
| PubChem CID | 86343735 |
| Molecular Formula | C11H11ClF3N5O |
| Molecular Weight | 321.69 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | N'-[N'-[3-chloro-4-(trifluoromethoxy)phenyl]carbamimidoyl]aziridine-1-carboximidamide |
| SMILES | NC(=N\c1ccc(OC(F)(F)F)c(Cl)c1)/N=C(\N)N1CC1 |
| InChI | InChI=1S/C11H11ClF3N5O/c12-7-5-6(1-2-8(7)21-11(13,14)15)18-9(16)19-10(17)20-3-4-20/h1-2,5H,3-4H2,(H4,16,17,18,19) |
| InChIKey | JODLXNVZHDZTOE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.69 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|