C14H19F3N6O — CID 121358281
4-methyl-N'-[N'-[3-(trifluoromethoxy)phenyl]carbamimidoyl]piperazine-1-carboximidamide (PubChem CID 121358281) has the molecular formula C14H19F3N6O and a molecular weight of 344.34 g/mol. Its IUPAC name is 4-methyl-N'-[N'-[3-(trifluoromethoxy)phenyl]carbamimidoyl]piperazine-1-carboximidamide.
| Compound Name | 4-methyl-N'-[N'-[3-(trifluoromethoxy)phenyl]carbamimidoyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 121358281 |
| Molecular Formula | C14H19F3N6O |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 4-methyl-N'-[N'-[3-(trifluoromethoxy)phenyl]carbamimidoyl]piperazine-1-carboximidamide |
| SMILES | CN1CCN(/C(N)=N/C(N)=N/c2cccc(OC(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C14H19F3N6O/c1-22-5-7-23(8-6-22)13(19)21-12(18)20-10-3-2-4-11(9-10)24-14(15,16)17/h2-4,9H,5-8H2,1H3,(H4,18,19,20,21) |
| InChIKey | CVHULPQNZSKUKQ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|