C18H26FN3 — CID 111091582
N'-[[1-(4-fluorophenyl)cyclobutyl]methyl]-3-methylpiperidine-1-carboximidamide (PubChem CID 111091582) has the molecular formula C18H26FN3 and a molecular weight of 303.43 g/mol. Its IUPAC name is N'-[[1-(4-fluorophenyl)cyclobutyl]methyl]-3-methylpiperidine-1-carboximidamide.
| Compound Name | N'-[[1-(4-fluorophenyl)cyclobutyl]methyl]-3-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111091582 |
| Molecular Formula | C18H26FN3 |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | N'-[[1-(4-fluorophenyl)cyclobutyl]methyl]-3-methylpiperidine-1-carboximidamide |
| SMILES | CC1CCCN(/C(N)=N/CC2(c3ccc(F)cc3)CCC2)C1 |
| InChI | InChI=1S/C18H26FN3/c1-14-4-2-11-22(12-14)17(20)21-13-18(9-3-10-18)15-5-7-16(19)8-6-15/h5-8,14H,2-4,9-13H2,1H3,(H2,20,21) |
| InChIKey | SCAAPHCQVHWSMA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|