C16H24FN3O2 — CID 111082627
N'-[3-(4-fluorophenoxy)-2-hydroxypropyl]-3-methylpiperidine-1-carboximidamide (PubChem CID 111082627) has the molecular formula C16H24FN3O2 and a molecular weight of 309.38 g/mol. Its IUPAC name is N'-[3-(4-fluorophenoxy)-2-hydroxypropyl]-3-methylpiperidine-1-carboximidamide.
| Compound Name | N'-[3-(4-fluorophenoxy)-2-hydroxypropyl]-3-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111082627 |
| Molecular Formula | C16H24FN3O2 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | N'-[3-(4-fluorophenoxy)-2-hydroxypropyl]-3-methylpiperidine-1-carboximidamide |
| SMILES | CC1CCCN(/C(N)=N/CC(O)COc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C16H24FN3O2/c1-12-3-2-8-20(10-12)16(18)19-9-14(21)11-22-15-6-4-13(17)5-7-15/h4-7,12,14,21H,2-3,8-11H2,1H3,(H2,18,19) |
| InChIKey | HXCKOWFHYQJAOH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|