C17H27N3O2 — CID 111082489
N'-[2-hydroxy-3-(3-methylphenoxy)propyl]-3-methylpiperidine-1-carboximidamide (PubChem CID 111082489) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is N'-[2-hydroxy-3-(3-methylphenoxy)propyl]-3-methylpiperidine-1-carboximidamide.
| Compound Name | N'-[2-hydroxy-3-(3-methylphenoxy)propyl]-3-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111082489 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | N'-[2-hydroxy-3-(3-methylphenoxy)propyl]-3-methylpiperidine-1-carboximidamide |
| SMILES | Cc1cccc(OCC(O)C/N=C(\N)N2CCCC(C)C2)c1 |
| InChI | InChI=1S/C17H27N3O2/c1-13-5-3-7-16(9-13)22-12-15(21)10-19-17(18)20-8-4-6-14(2)11-20/h3,5,7,9,14-15,21H,4,6,8,10-12H2,1-2H3,(H2,18,19) |
| InChIKey | POBRWOSDYDUGPB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|