C16H25IN4O4 — CID 111082304
N'-[2-hydroxy-3-(4-nitrophenoxy)propyl]-3-methylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111082304) has the molecular formula C16H25IN4O4 and a molecular weight of 464.30 g/mol. Its IUPAC name is N'-[2-hydroxy-3-(4-nitrophenoxy)propyl]-3-methylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-hydroxy-3-(4-nitrophenoxy)propyl]-3-methylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111082304 |
| Molecular Formula | C16H25IN4O4 |
| Molecular Weight | 464.30 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | N'-[2-hydroxy-3-(4-nitrophenoxy)propyl]-3-methylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CC1CCCN(/C(N)=N/CC(O)COc2ccc([N+](=O)[O-])cc2)C1.I |
| InChI | InChI=1S/C16H24N4O4.HI/c1-12-3-2-8-19(10-12)16(17)18-9-14(21)11-24-15-6-4-13(5-7-15)20(22)23;/h4-7,12,14,21H,2-3,8-11H2,1H3,(H2,17,18);1H |
| InChIKey | JLMVFMALYQLNAC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 114.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|