C12H17N5O2 — CID 124908137
(3S)-3-methyl-N'-(5-nitro-2-pyridinyl)piperidine-1-carboximidamide (PubChem CID 124908137) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is (3S)-3-methyl-N'-(5-nitro-2-pyridinyl)piperidine-1-carboximidamide.
| Compound Name | (3S)-3-methyl-N'-(5-nitro-2-pyridinyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 124908137 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | (3S)-3-methyl-N'-(5-nitro-2-pyridinyl)piperidine-1-carboximidamide |
| SMILES | C[C@H]1CCCN(/C(N)=N/c2ccc([N+](=O)[O-])cn2)C1 |
| InChI | InChI=1S/C12H17N5O2/c1-9-3-2-6-16(8-9)12(13)15-11-5-4-10(7-14-11)17(18)19/h4-5,7,9H,2-3,6,8H2,1H3,(H2,13,14,15)/t9-/m0/s1 |
| InChIKey | KKATVRFXKMTTGL-VIFPVBQESA-N |
| XLogP | 1.67 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|