C15H21F2N3O — CID 111806118
N'-[2-(3,4-difluorophenoxy)ethyl]-3-methylpiperidine-1-carboximidamide (PubChem CID 111806118) has the molecular formula C15H21F2N3O and a molecular weight of 297.35 g/mol. Its IUPAC name is N'-[2-(3,4-difluorophenoxy)ethyl]-3-methylpiperidine-1-carboximidamide.
| Compound Name | N'-[2-(3,4-difluorophenoxy)ethyl]-3-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111806118 |
| Molecular Formula | C15H21F2N3O |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N'-[2-(3,4-difluorophenoxy)ethyl]-3-methylpiperidine-1-carboximidamide |
| SMILES | CC1CCCN(/C(N)=N/CCOc2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C15H21F2N3O/c1-11-3-2-7-20(10-11)15(18)19-6-8-21-12-4-5-13(16)14(17)9-12/h4-5,9,11H,2-3,6-8,10H2,1H3,(H2,18,19) |
| InChIKey | DXQVMEYPYCOETJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|