C15H20FN3S — CID 111068160
N'-[[1-(4-fluorophenyl)cyclopropyl]methyl]thiomorpholine-4-carboximidamide (PubChem CID 111068160) has the molecular formula C15H20FN3S and a molecular weight of 293.41 g/mol. Its IUPAC name is N'-[[1-(4-fluorophenyl)cyclopropyl]methyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[[1-(4-fluorophenyl)cyclopropyl]methyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111068160 |
| Molecular Formula | C15H20FN3S |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | N'-[[1-(4-fluorophenyl)cyclopropyl]methyl]thiomorpholine-4-carboximidamide |
| SMILES | N/C(=N\CC1(c2ccc(F)cc2)CC1)N1CCSCC1 |
| InChI | InChI=1S/C15H20FN3S/c16-13-3-1-12(2-4-13)15(5-6-15)11-18-14(17)19-7-9-20-10-8-19/h1-4H,5-11H2,(H2,17,18) |
| InChIKey | LWWOBEGDCPLSDI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|