C13H17F2N3S — CID 111801624
N'-[2-(2,4-difluorophenyl)ethyl]thiomorpholine-4-carboximidamide (PubChem CID 111801624) has the molecular formula C13H17F2N3S and a molecular weight of 285.36 g/mol. Its IUPAC name is N'-[2-(2,4-difluorophenyl)ethyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[2-(2,4-difluorophenyl)ethyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111801624 |
| Molecular Formula | C13H17F2N3S |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | N'-[2-(2,4-difluorophenyl)ethyl]thiomorpholine-4-carboximidamide |
| SMILES | N/C(=N\CCc1ccc(F)cc1F)N1CCSCC1 |
| InChI | InChI=1S/C13H17F2N3S/c14-11-2-1-10(12(15)9-11)3-4-17-13(16)18-5-7-19-8-6-18/h1-2,9H,3-8H2,(H2,16,17) |
| InChIKey | VWDKTDURNKKLBQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|