C16H22N4S — CID 111808934
N'-[2-(7-methyl-1H-indol-3-yl)ethyl]thiomorpholine-4-carboximidamide (PubChem CID 111808934) has the molecular formula C16H22N4S and a molecular weight of 302.45 g/mol. Its IUPAC name is N'-[2-(7-methyl-1H-indol-3-yl)ethyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[2-(7-methyl-1H-indol-3-yl)ethyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111808934 |
| Molecular Formula | C16H22N4S |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | N'-[2-(7-methyl-1H-indol-3-yl)ethyl]thiomorpholine-4-carboximidamide |
| SMILES | Cc1cccc2c(CC/N=C(\N)N3CCSCC3)c[nH]c12 |
| InChI | InChI=1S/C16H22N4S/c1-12-3-2-4-14-13(11-19-15(12)14)5-6-18-16(17)20-7-9-21-10-8-20/h2-4,11,19H,5-10H2,1H3,(H2,17,18) |
| InChIKey | GWTQHGAFHPLHBV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 57.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|