C18H28IN3OS — CID 111807341
N'-[[1-(3-methoxyphenyl)cyclopentyl]methyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 111807341) has the molecular formula C18H28IN3OS and a molecular weight of 461.41 g/mol. Its IUPAC name is N'-[[1-(3-methoxyphenyl)cyclopentyl]methyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[[1-(3-methoxyphenyl)cyclopentyl]methyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111807341 |
| Molecular Formula | C18H28IN3OS |
| Molecular Weight | 461.41 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | N'-[[1-(3-methoxyphenyl)cyclopentyl]methyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | COc1cccc(C2(C/N=C(\N)N3CCSCC3)CCCC2)c1.I |
| InChI | InChI=1S/C18H27N3OS.HI/c1-22-16-6-4-5-15(13-16)18(7-2-3-8-18)14-20-17(19)21-9-11-23-12-10-21;/h4-6,13H,2-3,7-12,14H2,1H3,(H2,19,20);1H |
| InChIKey | IPCMJRRFJWXYPT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|