C16H23BrIN3 — CID 111812111
N'-[[1-(3-bromophenyl)cyclopropyl]methyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111812111) has the molecular formula C16H23BrIN3 and a molecular weight of 464.19 g/mol. Its IUPAC name is N'-[[1-(3-bromophenyl)cyclopropyl]methyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[1-(3-bromophenyl)cyclopropyl]methyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111812111 |
| Molecular Formula | C16H23BrIN3 |
| Molecular Weight | 464.19 g/mol |
| Exact Mass | 463.01 |
| IUPAC Name | N'-[[1-(3-bromophenyl)cyclopropyl]methyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CC1(c2cccc(Br)c2)CC1)N1CCCCC1 |
| InChI | InChI=1S/C16H22BrN3.HI/c17-14-6-4-5-13(11-14)16(7-8-16)12-19-15(18)20-9-2-1-3-10-20;/h4-6,11H,1-3,7-10,12H2,(H2,18,19);1H |
| InChIKey | UYOVHLVTTISLFC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.19 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|