C12H16BrN3 — CID 110918036
2-[[1-(3-bromophenyl)cyclobutyl]methyl]guanidine (PubChem CID 110918036) has the molecular formula C12H16BrN3 and a molecular weight of 282.19 g/mol. Its IUPAC name is 2-[[1-(3-bromophenyl)cyclobutyl]methyl]guanidine.
| Compound Name | 2-[[1-(3-bromophenyl)cyclobutyl]methyl]guanidine |
|---|---|
| PubChem CID | 110918036 |
| Molecular Formula | C12H16BrN3 |
| Molecular Weight | 282.19 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 2-[[1-(3-bromophenyl)cyclobutyl]methyl]guanidine |
| SMILES | NC(N)=NCC1(c2cccc(Br)c2)CCC1 |
| InChI | InChI=1S/C12H16BrN3/c13-10-4-1-3-9(7-10)12(5-2-6-12)8-16-11(14)15/h1,3-4,7H,2,5-6,8H2,(H4,14,15,16) |
| InChIKey | HVNMJPQOICNKGM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.19 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|