C16H24BrN3 — CID 111077393
2-[[1-(3-bromophenyl)cyclobutyl]methyl]-1,1-diethylguanidine (PubChem CID 111077393) has the molecular formula C16H24BrN3 and a molecular weight of 338.29 g/mol. Its IUPAC name is 2-[[1-(3-bromophenyl)cyclobutyl]methyl]-1,1-diethylguanidine.
| Compound Name | 2-[[1-(3-bromophenyl)cyclobutyl]methyl]-1,1-diethylguanidine |
|---|---|
| PubChem CID | 111077393 |
| Molecular Formula | C16H24BrN3 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 2-[[1-(3-bromophenyl)cyclobutyl]methyl]-1,1-diethylguanidine |
| SMILES | CCN(CC)/C(N)=N/CC1(c2cccc(Br)c2)CCC1 |
| InChI | InChI=1S/C16H24BrN3/c1-3-20(4-2)15(18)19-12-16(9-6-10-16)13-7-5-8-14(17)11-13/h5,7-8,11H,3-4,6,9-10,12H2,1-2H3,(H2,18,19) |
| InChIKey | DNDORKLRHIZMOX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|