C15H23BrIN3 — CID 111572858
2-[[1-(3-bromophenyl)cyclopropyl]methyl]-3-ethyl-1,1-dimethylguanidine;hydroiodide (PubChem CID 111572858) has the molecular formula C15H23BrIN3 and a molecular weight of 452.18 g/mol. Its IUPAC name is 2-[[1-(3-bromophenyl)cyclopropyl]methyl]-3-ethyl-1,1-dimethylguanidine;hydroiodide.
| Compound Name | 2-[[1-(3-bromophenyl)cyclopropyl]methyl]-3-ethyl-1,1-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111572858 |
| Molecular Formula | C15H23BrIN3 |
| Molecular Weight | 452.18 g/mol |
| Exact Mass | 451.01 |
| IUPAC Name | 2-[[1-(3-bromophenyl)cyclopropyl]methyl]-3-ethyl-1,1-dimethylguanidine;hydroiodide |
| SMILES | CCN/C(=N/CC1(c2cccc(Br)c2)CC1)N(C)C.I |
| InChI | InChI=1S/C15H22BrN3.HI/c1-4-17-14(19(2)3)18-11-15(8-9-15)12-6-5-7-13(16)10-12;/h5-7,10H,4,8-9,11H2,1-3H3,(H,17,18);1H |
| InChIKey | WZQNNAGWIOSRPM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.18 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|