C19H27BrIN5 — CID 111572402
2-[[1-(3-bromophenyl)cyclopropyl]methyl]-1-ethyl-3-(3-imidazol-1-ylpropyl)guanidine;hydroiodide (PubChem CID 111572402) has the molecular formula C19H27BrIN5 and a molecular weight of 532.27 g/mol. Its IUPAC name is 2-[[1-(3-bromophenyl)cyclopropyl]methyl]-1-ethyl-3-(3-imidazol-1-ylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[[1-(3-bromophenyl)cyclopropyl]methyl]-1-ethyl-3-(3-imidazol-1-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111572402 |
| Molecular Formula | C19H27BrIN5 |
| Molecular Weight | 532.27 g/mol |
| Exact Mass | 531.05 |
| IUPAC Name | 2-[[1-(3-bromophenyl)cyclopropyl]methyl]-1-ethyl-3-(3-imidazol-1-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1(c2cccc(Br)c2)CC1)NCCCn1ccnc1.I |
| InChI | InChI=1S/C19H26BrN5.HI/c1-2-22-18(23-9-4-11-25-12-10-21-15-25)24-14-19(7-8-19)16-5-3-6-17(20)13-16;/h3,5-6,10,12-13,15H,2,4,7-9,11,14H2,1H3,(H2,22,23,24);1H |
| InChIKey | VFZXAQZZWGPZLI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.27 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|