C20H29BrIN3O — CID 109393191
2-[[1-(3-bromophenyl)cyclopropyl]methyl]-1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-ethylguanidine;hydroiodide (PubChem CID 109393191) has the molecular formula C20H29BrIN3O and a molecular weight of 534.28 g/mol. Its IUPAC name is 2-[[1-(3-bromophenyl)cyclopropyl]methyl]-1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[[1-(3-bromophenyl)cyclopropyl]methyl]-1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109393191 |
| Molecular Formula | C20H29BrIN3O |
| Molecular Weight | 534.28 g/mol |
| Exact Mass | 533.05 |
| IUPAC Name | 2-[[1-(3-bromophenyl)cyclopropyl]methyl]-1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1(c2cccc(Br)c2)CC1)NCCC1=CCOCC1.I |
| InChI | InChI=1S/C20H28BrN3O.HI/c1-2-22-19(23-11-6-16-7-12-25-13-8-16)24-15-20(9-10-20)17-4-3-5-18(21)14-17;/h3-5,7,14H,2,6,8-13,15H2,1H3,(H2,22,23,24);1H |
| InChIKey | RWGFCHRQFHFKRM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.28 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|