C19H27BrFN3O — CID 109393270
2-[3-(4-bromo-2-fluorophenyl)propyl]-1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-ethylguanidine (PubChem CID 109393270) has the molecular formula C19H27BrFN3O and a molecular weight of 412.35 g/mol. Its IUPAC name is 2-[3-(4-bromo-2-fluorophenyl)propyl]-1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-ethylguanidine.
| Compound Name | 2-[3-(4-bromo-2-fluorophenyl)propyl]-1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 109393270 |
| Molecular Formula | C19H27BrFN3O |
| Molecular Weight | 412.35 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 2-[3-(4-bromo-2-fluorophenyl)propyl]-1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CCCc1ccc(Br)cc1F)NCCC1=CCOCC1 |
| InChI | InChI=1S/C19H27BrFN3O/c1-2-22-19(24-11-7-15-8-12-25-13-9-15)23-10-3-4-16-5-6-17(20)14-18(16)21/h5-6,8,14H,2-4,7,9-13H2,1H3,(H2,22,23,24) |
| InChIKey | AUBREMGLBOMWEN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|