C18H29BrFN3O — CID 111604367
2-[3-(4-bromo-2-fluorophenyl)propyl]-1-(4-ethoxybutyl)-3-ethylguanidine (PubChem CID 111604367) has the molecular formula C18H29BrFN3O and a molecular weight of 402.35 g/mol. Its IUPAC name is 2-[3-(4-bromo-2-fluorophenyl)propyl]-1-(4-ethoxybutyl)-3-ethylguanidine.
| Compound Name | 2-[3-(4-bromo-2-fluorophenyl)propyl]-1-(4-ethoxybutyl)-3-ethylguanidine |
|---|---|
| PubChem CID | 111604367 |
| Molecular Formula | C18H29BrFN3O |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 2-[3-(4-bromo-2-fluorophenyl)propyl]-1-(4-ethoxybutyl)-3-ethylguanidine |
| SMILES | CCN/C(=N\CCCc1ccc(Br)cc1F)NCCCCOCC |
| InChI | InChI=1S/C18H29BrFN3O/c1-3-21-18(22-11-5-6-13-24-4-2)23-12-7-8-15-9-10-16(19)14-17(15)20/h9-10,14H,3-8,11-13H2,1-2H3,(H2,21,22,23) |
| InChIKey | OPRNIOIWHDLNKJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|