C15H23BrFN3O — CID 111946153
1-[(5-bromo-2-fluorophenyl)methyl]-3-(4-ethoxybutyl)-2-methylguanidine (PubChem CID 111946153) has the molecular formula C15H23BrFN3O and a molecular weight of 360.27 g/mol. Its IUPAC name is 1-[(5-bromo-2-fluorophenyl)methyl]-3-(4-ethoxybutyl)-2-methylguanidine.
| Compound Name | 1-[(5-bromo-2-fluorophenyl)methyl]-3-(4-ethoxybutyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111946153 |
| Molecular Formula | C15H23BrFN3O |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 1-[(5-bromo-2-fluorophenyl)methyl]-3-(4-ethoxybutyl)-2-methylguanidine |
| SMILES | CCOCCCCN/C(=N\C)NCc1cc(Br)ccc1F |
| InChI | InChI=1S/C15H23BrFN3O/c1-3-21-9-5-4-8-19-15(18-2)20-11-12-10-13(16)6-7-14(12)17/h6-7,10H,3-5,8-9,11H2,1-2H3,(H2,18,19,20) |
| InChIKey | VFHORTXHRBMAAT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|