C18H28BrFIN3O — CID 111979428
2-[3-(4-bromo-2-fluorophenyl)propyl]-1-ethyl-3-(4-hydroxycyclohexyl)guanidine;hydroiodide (PubChem CID 111979428) has the molecular formula C18H28BrFIN3O and a molecular weight of 528.25 g/mol. Its IUPAC name is 2-[3-(4-bromo-2-fluorophenyl)propyl]-1-ethyl-3-(4-hydroxycyclohexyl)guanidine;hydroiodide.
| Compound Name | 2-[3-(4-bromo-2-fluorophenyl)propyl]-1-ethyl-3-(4-hydroxycyclohexyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111979428 |
| Molecular Formula | C18H28BrFIN3O |
| Molecular Weight | 528.25 g/mol |
| Exact Mass | 527.04 |
| IUPAC Name | 2-[3-(4-bromo-2-fluorophenyl)propyl]-1-ethyl-3-(4-hydroxycyclohexyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCc1ccc(Br)cc1F)NC1CCC(O)CC1.I |
| InChI | InChI=1S/C18H27BrFN3O.HI/c1-2-21-18(23-15-7-9-16(24)10-8-15)22-11-3-4-13-5-6-14(19)12-17(13)20;/h5-6,12,15-16,24H,2-4,7-11H2,1H3,(H2,21,22,23);1H |
| InChIKey | VEWXDQUAASEOSY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.25 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|