C17H25F2N3O2 — CID 111979027
2-[2-(2,4-difluorophenoxy)ethyl]-1-ethyl-3-(4-hydroxycyclohexyl)guanidine (PubChem CID 111979027) has the molecular formula C17H25F2N3O2 and a molecular weight of 341.40 g/mol. Its IUPAC name is 2-[2-(2,4-difluorophenoxy)ethyl]-1-ethyl-3-(4-hydroxycyclohexyl)guanidine.
| Compound Name | 2-[2-(2,4-difluorophenoxy)ethyl]-1-ethyl-3-(4-hydroxycyclohexyl)guanidine |
|---|---|
| PubChem CID | 111979027 |
| Molecular Formula | C17H25F2N3O2 |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 2-[2-(2,4-difluorophenoxy)ethyl]-1-ethyl-3-(4-hydroxycyclohexyl)guanidine |
| SMILES | CCN/C(=N\CCOc1ccc(F)cc1F)NC1CCC(O)CC1 |
| InChI | InChI=1S/C17H25F2N3O2/c1-2-20-17(22-13-4-6-14(23)7-5-13)21-9-10-24-16-8-3-12(18)11-15(16)19/h3,8,11,13-14,23H,2,4-7,9-10H2,1H3,(H2,20,21,22) |
| InChIKey | PRTWAVWLSDSDAX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|