C18H28F2IN3O — CID 111979564
2-[2-(2,4-difluorophenyl)propyl]-1-ethyl-3-(4-hydroxycyclohexyl)guanidine;hydroiodide (PubChem CID 111979564) has the molecular formula C18H28F2IN3O and a molecular weight of 467.34 g/mol. Its IUPAC name is 2-[2-(2,4-difluorophenyl)propyl]-1-ethyl-3-(4-hydroxycyclohexyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(2,4-difluorophenyl)propyl]-1-ethyl-3-(4-hydroxycyclohexyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111979564 |
| Molecular Formula | C18H28F2IN3O |
| Molecular Weight | 467.34 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | 2-[2-(2,4-difluorophenyl)propyl]-1-ethyl-3-(4-hydroxycyclohexyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)c1ccc(F)cc1F)NC1CCC(O)CC1.I |
| InChI | InChI=1S/C18H27F2N3O.HI/c1-3-21-18(23-14-5-7-15(24)8-6-14)22-11-12(2)16-9-4-13(19)10-17(16)20;/h4,9-10,12,14-15,24H,3,5-8,11H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | IXYYZRLFDXFFJJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|