C18H30F2IN3O2 — CID 111768714
2-[2-(2,4-difluorophenyl)propyl]-1-ethyl-3-[3-(2-methoxyethoxy)propyl]guanidine;hydroiodide (PubChem CID 111768714) has the molecular formula C18H30F2IN3O2 and a molecular weight of 485.36 g/mol. Its IUPAC name is 2-[2-(2,4-difluorophenyl)propyl]-1-ethyl-3-[3-(2-methoxyethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(2,4-difluorophenyl)propyl]-1-ethyl-3-[3-(2-methoxyethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111768714 |
| Molecular Formula | C18H30F2IN3O2 |
| Molecular Weight | 485.36 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | 2-[2-(2,4-difluorophenyl)propyl]-1-ethyl-3-[3-(2-methoxyethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)c1ccc(F)cc1F)NCCCOCCOC.I |
| InChI | InChI=1S/C18H29F2N3O2.HI/c1-4-21-18(22-8-5-9-25-11-10-24-3)23-13-14(2)16-7-6-15(19)12-17(16)20;/h6-7,12,14H,4-5,8-11,13H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | ZNSJVLKOMZRRRW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|