C16H23F2N3 — CID 111807518
1-cyclohexyl-2-[2-(2,4-difluorophenyl)propyl]guanidine (PubChem CID 111807518) has the molecular formula C16H23F2N3 and a molecular weight of 295.38 g/mol. Its IUPAC name is 1-cyclohexyl-2-[2-(2,4-difluorophenyl)propyl]guanidine.
| Compound Name | 1-cyclohexyl-2-[2-(2,4-difluorophenyl)propyl]guanidine |
|---|---|
| PubChem CID | 111807518 |
| Molecular Formula | C16H23F2N3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 1-cyclohexyl-2-[2-(2,4-difluorophenyl)propyl]guanidine |
| SMILES | CC(C/N=C(\N)NC1CCCCC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H23F2N3/c1-11(14-8-7-12(17)9-15(14)18)10-20-16(19)21-13-5-3-2-4-6-13/h7-9,11,13H,2-6,10H2,1H3,(H3,19,20,21) |
| InChIKey | PZWBJYMWVXMVTM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|