C14H19ClFN3O — CID 122082261
2-[2-(3-chloro-5-fluorophenyl)-2-hydroxyethyl]-1-cyclopentylguanidine (PubChem CID 122082261) has the molecular formula C14H19ClFN3O and a molecular weight of 299.78 g/mol. Its IUPAC name is 2-[2-(3-chloro-5-fluorophenyl)-2-hydroxyethyl]-1-cyclopentylguanidine.
| Compound Name | 2-[2-(3-chloro-5-fluorophenyl)-2-hydroxyethyl]-1-cyclopentylguanidine |
|---|---|
| PubChem CID | 122082261 |
| Molecular Formula | C14H19ClFN3O |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-[2-(3-chloro-5-fluorophenyl)-2-hydroxyethyl]-1-cyclopentylguanidine |
| SMILES | N/C(=N\CC(O)c1cc(F)cc(Cl)c1)NC1CCCC1 |
| InChI | InChI=1S/C14H19ClFN3O/c15-10-5-9(6-11(16)7-10)13(20)8-18-14(17)19-12-3-1-2-4-12/h5-7,12-13,20H,1-4,8H2,(H3,17,18,19) |
| InChIKey | SLYWNORMAADWOO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|