C16H23N3 — CID 122096278
1-cyclobutyl-2-(2-cyclopropyl-2-phenylethyl)guanidine (PubChem CID 122096278) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is 1-cyclobutyl-2-(2-cyclopropyl-2-phenylethyl)guanidine.
| Compound Name | 1-cyclobutyl-2-(2-cyclopropyl-2-phenylethyl)guanidine |
|---|---|
| PubChem CID | 122096278 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | 1-cyclobutyl-2-(2-cyclopropyl-2-phenylethyl)guanidine |
| SMILES | N/C(=N\CC(c1ccccc1)C1CC1)NC1CCC1 |
| InChI | InChI=1S/C16H23N3/c17-16(19-14-7-4-8-14)18-11-15(13-9-10-13)12-5-2-1-3-6-12/h1-3,5-6,13-15H,4,7-11H2,(H3,17,18,19) |
| InChIKey | PPLYKBJIKXAPPL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|