C15H22ClN3O — CID 111801100
2-[2-(2-chlorophenyl)-2-hydroxyethyl]-1-cyclohexylguanidine (PubChem CID 111801100) has the molecular formula C15H22ClN3O and a molecular weight of 295.81 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-2-hydroxyethyl]-1-cyclohexylguanidine.
| Compound Name | 2-[2-(2-chlorophenyl)-2-hydroxyethyl]-1-cyclohexylguanidine |
|---|---|
| PubChem CID | 111801100 |
| Molecular Formula | C15H22ClN3O |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 2-[2-(2-chlorophenyl)-2-hydroxyethyl]-1-cyclohexylguanidine |
| SMILES | N/C(=N\CC(O)c1ccccc1Cl)NC1CCCCC1 |
| InChI | InChI=1S/C15H22ClN3O/c16-13-9-5-4-8-12(13)14(20)10-18-15(17)19-11-6-2-1-3-7-11/h4-5,8-9,11,14,20H,1-3,6-7,10H2,(H3,17,18,19) |
| InChIKey | SPWLPWIIIDHCKN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|