C17H25ClN4O3 — CID 111801062
ethyl 4-[[N'-[2-(2-chlorophenyl)-2-hydroxyethyl]carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111801062) has the molecular formula C17H25ClN4O3 and a molecular weight of 368.87 g/mol. Its IUPAC name is ethyl 4-[[N'-[2-(2-chlorophenyl)-2-hydroxyethyl]carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N'-[2-(2-chlorophenyl)-2-hydroxyethyl]carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111801062 |
| Molecular Formula | C17H25ClN4O3 |
| Molecular Weight | 368.87 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | ethyl 4-[[N'-[2-(2-chlorophenyl)-2-hydroxyethyl]carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/CC(O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C17H25ClN4O3/c1-2-25-17(24)22-9-7-12(8-10-22)21-16(19)20-11-15(23)13-5-3-4-6-14(13)18/h3-6,12,15,23H,2,7-11H2,1H3,(H3,19,20,21) |
| InChIKey | RGSXJXFUYUYDOR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.87 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|