C19H31N5O2S — CID 111029870
ethyl 4-[[N'-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111029870) has the molecular formula C19H31N5O2S and a molecular weight of 393.56 g/mol. Its IUPAC name is ethyl 4-[[N'-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N'-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111029870 |
| Molecular Formula | C19H31N5O2S |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | ethyl 4-[[N'-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/CC(c2cccs2)N2CCCC2)CC1 |
| InChI | InChI=1S/C19H31N5O2S/c1-2-26-19(25)24-11-7-15(8-12-24)22-18(20)21-14-16(17-6-5-13-27-17)23-9-3-4-10-23/h5-6,13,15-16H,2-4,7-12,14H2,1H3,(H3,20,21,22) |
| InChIKey | SQCJLCHYIYCBFU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 83.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|